CAS 2140327-38-2 is the registry number for Fenamiphos-sulfoxide d3 (S-methyl d3). Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
N-[ethoxy-[3-methyl-4-(trideuteriomethylsulfinyl)phenoxy]phosphoryl]propan-2-amine (CAS 2140327-38-2) is a chemical compound with the molecular formula C13H22NO4PS and a molecular weight of 322.38 g/mol. IUPAC name: N-[ethoxy-[3-methyl-4-(trideuteriomethylsulfinyl)phenoxy]phosphoryl]propan-2-amine. InChIKey: LUQMWGMGWJEGAT-VPYROQPTSA-N.
| Molecular formula | C13H22NO4PS |
|---|---|
| Molecular weight | 322.38 g/mol |
| IUPAC name | N-[ethoxy-[3-methyl-4-(trideuteriomethylsulfinyl)phenoxy]phosphoryl]propan-2-amine |
| InChIKey | LUQMWGMGWJEGAT-VPYROQPTSA-N |
| SMILES | [2H]C([2H])([2H])S(=O)C1=C(C=C(C=C1)OP(=O)(NC(C)C)OCC)C |
Computed by PubChem (NCBI)