Products 2140327-68-8
CAS 2140327-68-8 is the registry number for Methoxyfenozide-d3. Offered by: TRC. Available pack sizes: 100mg.
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-3-(trideuteriomethoxy)benzohydrazide (CAS 2140327-68-8) is a chemical compound with the molecular formula C22H28N2O3 and a molecular weight of 371.5 g/mol. IUPAC name: N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-3-(trideuteriomethoxy)benzohydrazide. InChIKey: QCAWEPFNJXQPAN-UKDQJQFQSA-N.
| Molecular formula | C22H28N2O3 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2-methyl-3-(trideuteriomethoxy)benzohydrazide |
| InChIKey | QCAWEPFNJXQPAN-UKDQJQFQSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC(=C1C)C(=O)NN(C(=O)C2=CC(=CC(=C2)C)C)C(C)(C)C |
Computed by PubChem (NCBI)