CAS 2140327-71-3 appears in our catalog under these names: D5-Ethoxyquin, D5-Ethoxyquin, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x5mg, 1x1ml.
2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-3,4-dihydro-1H-quinoline (CAS 2140327-71-3) is a chemical compound with the molecular formula C14H21NO and a molecular weight of 224.35 g/mol. IUPAC name: 2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-3,4-dihydro-1H-quinoline. InChIKey: YLDDCEXDGNXCIO-RPIBLTHZSA-N.
| Molecular formula | C14H21NO |
|---|---|
| Molecular weight | 224.35 g/mol |
| IUPAC name | 2,2,4-trimethyl-6-(1,1,2,2,2-pentadeuterioethoxy)-3,4-dihydro-1H-quinoline |
| InChIKey | YLDDCEXDGNXCIO-RPIBLTHZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC2=C(C=C1)NC(CC2C)(C)C |
Computed by PubChem (NCBI)