CAS 2140803-84-3 is the registry number for 2,6-Dichloro-3-(hydrazonomethyl)pyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-(2,6-dichloro-3-pyridinyl)methylidenehydrazine (CAS 2140803-84-3) is a chemical compound with the molecular formula C6H5Cl2N3 and a molecular weight of 190.03 g/mol. IUPAC name: (E)-(2,6-dichloro-3-pyridinyl)methylidenehydrazine. InChIKey: BNNSTJHRZJXMCO-XCVCLJGOSA-N.
| Molecular formula | C6H5Cl2N3 |
|---|---|
| Molecular weight | 190.03 g/mol |
| IUPAC name | (E)-(2,6-dichloro-3-pyridinyl)methylidenehydrazine |
| InChIKey | BNNSTJHRZJXMCO-XCVCLJGOSA-N |
| SMILES | C1=CC(=NC(=C1/C=N/N)Cl)Cl |
Computed by PubChem (NCBI)