CAS 214139-86-3 is the registry number for N-Cyclopropyl L-Valinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S)-2-amino-N-cyclopropyl-3-methylbutanamide (CAS 214139-86-3) is a chemical compound with the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. IUPAC name: (2S)-2-amino-N-cyclopropyl-3-methylbutanamide. InChIKey: SUGIDOGORBKDKV-ZETCQYMHSA-N.
| Molecular formula | C8H16N2O |
|---|---|
| Molecular weight | 156.23 g/mol |
| IUPAC name | (2S)-2-amino-N-cyclopropyl-3-methylbutanamide |
| InChIKey | SUGIDOGORBKDKV-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1CC1)N |
Computed by PubChem (NCBI)