Products 214195-92-3

CAS 214195-92-3 is the registry number for Gadobutrol Impurity 60. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

8,12-dimethyl-1,4,7,9-tetrazatricyclo[6.3.1.04,12]dodecane (CAS 214195-92-3) is a chemical compound with the molecular formula C10H20N4 and a molecular weight of 196.29 g/mol. IUPAC name: 8,12-dimethyl-1,4,7,9-tetrazatricyclo[6.3.1.04,12]dodecane. InChIKey: FBZJILZAOVQRLE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20N4
Molecular weight196.29 g/mol
IUPAC name8,12-dimethyl-1,4,7,9-tetrazatricyclo[6.3.1.04,12]dodecane
InChIKeyFBZJILZAOVQRLE-UHFFFAOYSA-N
SMILESCC12C3(N(CCN1)CCN3CCN2)C

Computed by PubChem (NCBI)