Products 214196-05-1

CAS 214196-05-1 is the registry number for Gadobutrol Impurity 62. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

13,14-dimethyl-1,4,7,10-tetrazatetracyclo[5.5.2.04,13.010,14]tetradecane (CAS 214196-05-1) is a chemical compound with the molecular formula C12H22N4 and a molecular weight of 222.33 g/mol. IUPAC name: 13,14-dimethyl-1,4,7,10-tetrazatetracyclo[5.5.2.04,13.010,14]tetradecane. InChIKey: UQDRDFZKYLBREX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N4
Molecular weight222.33 g/mol
IUPAC name13,14-dimethyl-1,4,7,10-tetrazatetracyclo[5.5.2.04,13.010,14]tetradecane
InChIKeyUQDRDFZKYLBREX-UHFFFAOYSA-N
SMILESCC12C3(N4CCN3CCN1CCN2CC4)C

Computed by PubChem (NCBI)