CAS 2141981-86-2 appears in our catalog under these names: Tco-peg3-acid, 95%, TCO–PEG3–acid, TCO-PEG3-acid 98% (E), 1-(Cyclooct-4-en-1-yloxy)-1-oxo-5,8,11-trioxa-2-azatetradecan-14-oic acid, 98%, 98%, TCO-PEG3-acid, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g, 25 mg, 5 mg, 50 mg.
3-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2141981-86-2) is a chemical compound with the molecular formula C18H31NO7 and a molecular weight of 373.4 g/mol. IUPAC name: 3-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LUXDTTWUFRONNF-UPHRSURJSA-N.
| Molecular formula | C18H31NO7 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LUXDTTWUFRONNF-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)