CAS 214210-16-9 is the registry number for 3-Bromo-N,4-dimethylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N,4-dimethylbenzamide (CAS 214210-16-9) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 3-bromo-N,4-dimethylbenzamide. InChIKey: JLCHRMSLYFGXER-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 3-bromo-N,4-dimethylbenzamide |
| InChIKey | JLCHRMSLYFGXER-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC)Br |
Computed by PubChem (NCBI)