CAS 214263-04-4 appears in our catalog under these names: 1-(2-Chloro-6-fluorophenyl)cyclohexanecarboxylic acid, 95%, 1–(2–chloro–6–fluorophenyl)cyclohexanecarboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(2-chloro-6-fluorophenyl)cyclohexane-1-carboxylic acid (CAS 214263-04-4) is a chemical compound with the molecular formula C13H14ClFO2 and a molecular weight of 256.70 g/mol. IUPAC name: 1-(2-chloro-6-fluorophenyl)cyclohexane-1-carboxylic acid. InChIKey: YOCRQRLRAGTUCP-UHFFFAOYSA-N.
| Molecular formula | C13H14ClFO2 |
|---|---|
| Molecular weight | 256.70 g/mol |
| IUPAC name | 1-(2-chloro-6-fluorophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | YOCRQRLRAGTUCP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=C(C=CC=C2Cl)F)C(=O)O |
Computed by PubChem (NCBI)