CAS 2143028-33-3 is the registry number for 2-Bromo-5-fluoro-1,3-diisopropylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-fluoro-1,3-di(propan-2-yl)benzene (CAS 2143028-33-3) is a chemical compound with the molecular formula C12H16BrF and a molecular weight of 259.16 g/mol. IUPAC name: 2-bromo-5-fluoro-1,3-di(propan-2-yl)benzene. InChIKey: IWJBJOXPKDOQPK-UHFFFAOYSA-N.
| Molecular formula | C12H16BrF |
|---|---|
| Molecular weight | 259.16 g/mol |
| IUPAC name | 2-bromo-5-fluoro-1,3-di(propan-2-yl)benzene |
| InChIKey | IWJBJOXPKDOQPK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1Br)C(C)C)F |
Computed by PubChem (NCBI)