Products 2143028-38-8
CAS 2143028-38-8 is the registry number for 4-Chloro-3,5-difluoro-2,6-diisopropylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3,5-difluoro-2,6-di(propan-2-yl)aniline (CAS 2143028-38-8) is a chemical compound with the molecular formula C12H16ClF2N and a molecular weight of 247.71 g/mol. IUPAC name: 4-chloro-3,5-difluoro-2,6-di(propan-2-yl)aniline. InChIKey: XPBIMRHLXSMMNT-UHFFFAOYSA-N.
| Molecular formula | C12H16ClF2N |
|---|---|
| Molecular weight | 247.71 g/mol |
| IUPAC name | 4-chloro-3,5-difluoro-2,6-di(propan-2-yl)aniline |
| InChIKey | XPBIMRHLXSMMNT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C(=C1F)Cl)F)C(C)C)N |
Computed by PubChem (NCBI)