CAS 2143028-49-1 is the registry number for 2-(2,6-Diisopropyl-4-(trifluoromethyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,6-di(propan-2-yl)-4-(trifluoromethyl)phenyl]acetic acid (CAS 2143028-49-1) is a chemical compound with the molecular formula C15H19F3O2 and a molecular weight of 288.30 g/mol. IUPAC name: 2-[2,6-di(propan-2-yl)-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: BFCCQQHIJRCQRM-UHFFFAOYSA-N.
| Molecular formula | C15H19F3O2 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 2-[2,6-di(propan-2-yl)-4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | BFCCQQHIJRCQRM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1CC(=O)O)C(C)C)C(F)(F)F |
Computed by PubChem (NCBI)