Products 2143028-49-1

CAS 2143028-49-1 is the registry number for 2-(2,6-Diisopropyl-4-(trifluoromethyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2,6-di(propan-2-yl)-4-(trifluoromethyl)phenyl]acetic acid (CAS 2143028-49-1) is a chemical compound with the molecular formula C15H19F3O2 and a molecular weight of 288.30 g/mol. IUPAC name: 2-[2,6-di(propan-2-yl)-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: BFCCQQHIJRCQRM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19F3O2
Molecular weight288.30 g/mol
IUPAC name2-[2,6-di(propan-2-yl)-4-(trifluoromethyl)phenyl]acetic acid
InChIKeyBFCCQQHIJRCQRM-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=CC(=C1CC(=O)O)C(C)C)C(F)(F)F

Computed by PubChem (NCBI)