CAS 2143028-53-7 is the registry number for 3,5-Difluoro-2,6-diisopropylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-difluoro-2,6-di(propan-2-yl)aniline (CAS 2143028-53-7) is a chemical compound with the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. IUPAC name: 3,5-difluoro-2,6-di(propan-2-yl)aniline. InChIKey: VZGADBZTZAJHCF-UHFFFAOYSA-N.
| Molecular formula | C12H17F2N |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 3,5-difluoro-2,6-di(propan-2-yl)aniline |
| InChIKey | VZGADBZTZAJHCF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1F)F)C(C)C)N |
Computed by PubChem (NCBI)