Products 2143028-56-0
CAS 2143028-56-0 is the registry number for 2-(3,5-Difluoro-2,6-diisopropylphenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3,5-difluoro-2,6-di(propan-2-yl)phenyl]acetic acid (CAS 2143028-56-0) is a chemical compound with the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. IUPAC name: 2-[3,5-difluoro-2,6-di(propan-2-yl)phenyl]acetic acid. InChIKey: TWHDEVCPPYAXKL-UHFFFAOYSA-N.
| Molecular formula | C14H18F2O2 |
|---|---|
| Molecular weight | 256.29 g/mol |
| IUPAC name | 2-[3,5-difluoro-2,6-di(propan-2-yl)phenyl]acetic acid |
| InChIKey | TWHDEVCPPYAXKL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1F)F)C(C)C)CC(=O)O |
Computed by PubChem (NCBI)