CAS 214327-89-6 appears in our catalog under these names: Methyl 3,5-dichloro-2-[(chloroacetyl)amino]benzoate, 95%, Methyl 3,5-dichloro-2-(2-chloroacetamido)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl 3,5-dichloro-2-[(2-chloroacetyl)amino]benzoate (CAS 214327-89-6) is a chemical compound with the molecular formula C10H8Cl3NO3 and a molecular weight of 296.5 g/mol. IUPAC name: methyl 3,5-dichloro-2-[(2-chloroacetyl)amino]benzoate. InChIKey: BQUHWTMYNAGXFV-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl3NO3 |
|---|---|
| Molecular weight | 296.5 g/mol |
| IUPAC name | methyl 3,5-dichloro-2-[(2-chloroacetyl)amino]benzoate |
| InChIKey | BQUHWTMYNAGXFV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)