CAS 214353-90-9 is the registry number for 4-(4-Cyanophenoxy)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(4-cyanophenoxy)benzenesulfonyl chloride (CAS 214353-90-9) is a chemical compound with the molecular formula C13H8ClNO3S and a molecular weight of 293.73 g/mol. IUPAC name: 4-(4-cyanophenoxy)benzenesulfonyl chloride. InChIKey: NPBRNBLZNUPDMG-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO3S |
|---|---|
| Molecular weight | 293.73 g/mol |
| IUPAC name | 4-(4-cyanophenoxy)benzenesulfonyl chloride |
| InChIKey | NPBRNBLZNUPDMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)