CAS 2143896-83-5 appears in our catalog under these names: PKUMDL–LC–101–D04, PKUMDL-LC-101-D04/ 98.71% (existing batch purity), PKUMDL-LC-101-D04 98%, N-(2-Aminoethyl)-4-(3-cyclopentylthioureido)benzenesulfonamide hydrochloride, 98%, 98%, PKUMDL-LC-101-D04, 99.83%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1-[4-(2-aminoethylsulfamoyl)phenyl]-3-cyclopentylthiourea;hydrochloride (CAS 2143896-83-5) is a chemical compound with the molecular formula C14H23ClN4O2S2 and a molecular weight of 378.9 g/mol. IUPAC name: 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-cyclopentylthiourea;hydrochloride. InChIKey: FELDRJSFLBINQS-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN4O2S2 |
|---|---|
| Molecular weight | 378.9 g/mol |
| IUPAC name | 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-cyclopentylthiourea;hydrochloride |
| InChIKey | FELDRJSFLBINQS-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=S)NC2=CC=C(C=C2)S(=O)(=O)NCCN.Cl |
Computed by PubChem (NCBI)