Products 2143944-64-1

CAS 2143944-64-1 is the registry number for Brexpiprazole Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane chloride (CAS 2143944-64-1) is a chemical compound with the molecular formula C16H21ClN2S and a molecular weight of 308.9 g/mol. IUPAC name: 8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane chloride. InChIKey: BTLIJNBYPANZRX-UHFFFAOYSA-M.

Identity
Molecular formulaC16H21ClN2S
Molecular weight308.9 g/mol
IUPAC name8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane chloride
InChIKeyBTLIJNBYPANZRX-UHFFFAOYSA-M
SMILESC1CC[N+]2(C1)CCN(CC2)C3=C4C=CSC4=CC=C3.[Cl-]

Computed by PubChem (NCBI)