CAS 2143944-64-1 is the registry number for Brexpiprazole Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane chloride (CAS 2143944-64-1) is a chemical compound with the molecular formula C16H21ClN2S and a molecular weight of 308.9 g/mol. IUPAC name: 8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane chloride. InChIKey: BTLIJNBYPANZRX-UHFFFAOYSA-M.
| Molecular formula | C16H21ClN2S |
|---|---|
| Molecular weight | 308.9 g/mol |
| IUPAC name | 8-(1-benzothiophen-4-yl)-8-aza-5-azoniaspiro[4.5]decane chloride |
| InChIKey | BTLIJNBYPANZRX-UHFFFAOYSA-M |
| SMILES | C1CC[N+]2(C1)CCN(CC2)C3=C4C=CSC4=CC=C3.[Cl-] |
Computed by PubChem (NCBI)