CAS 2145-56-4 appears in our catalog under these names: 5-(Trifluoromethyl)dihydropyrimidine-2,4(1h,3h)-dione, 95%, Trifluridine Impurity 10, 5-(Trifluoromethyl)dihydropyrimidine-2,4(1H,3H)-dione, >95% (HPLC), 5-(Trifluoromethyl)dihydropyrimidine-2,4(1H,3H)-dione 95+%, 5-(Trifluoromethyl)dihydropyrimidine-2,4(1H,3H)-dione, 95+%, 95+%. Offered by: Combi-blocks, Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, on request, 100mg, 500mg, 50mg.
5-(trifluoromethyl)-1,3-diazinane-2,4-dione (CAS 2145-56-4) is a chemical compound with the molecular formula C5H5F3N2O2 and a molecular weight of 182.10 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-diazinane-2,4-dione. InChIKey: ACYJXCFDMOGNSM-UHFFFAOYSA-N.
| Molecular formula | C5H5F3N2O2 |
|---|---|
| Molecular weight | 182.10 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-diazinane-2,4-dione |
| InChIKey | ACYJXCFDMOGNSM-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)