Products 2145093-87-2
CAS 2145093-87-2 appears in our catalog under these names: 2,6-Dichloro-4-(methylthio)benzyl alcohol, 95%, (2,6-Dichloro-4-(methylthio)phenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(2,6-dichloro-4-methylsulfanylphenyl)methanol (CAS 2145093-87-2) is a chemical compound with the molecular formula C8H8Cl2OS and a molecular weight of 223.12 g/mol. IUPAC name: (2,6-dichloro-4-methylsulfanylphenyl)methanol. InChIKey: SCINNMSGZFDBCE-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2OS |
|---|---|
| Molecular weight | 223.12 g/mol |
| IUPAC name | (2,6-dichloro-4-methylsulfanylphenyl)methanol |
| InChIKey | SCINNMSGZFDBCE-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C(=C1)Cl)CO)Cl |
Computed by PubChem (NCBI)