Products 21453-68-9
CAS 21453-68-9 is the registry number for Diayangambin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,3aR,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan (CAS 21453-68-9) is a chemical compound with the molecular formula C24H30O8 and a molecular weight of 446.5 g/mol. IUPAC name: (3R,3aR,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan. InChIKey: HRLFUIXSXUASEX-QDGJQWLKSA-N.
| Molecular formula | C24H30O8 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | (3R,3aR,6R,6aR)-3,6-bis(3,4,5-trimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan |
| InChIKey | HRLFUIXSXUASEX-QDGJQWLKSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@H]3CO[C@H]([C@H]3CO2)C4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)