CAS 214532-10-2 appears in our catalog under these names: 1-Methyl-1H-thieno(3,2-c)(1,2)thiazin-4(3H)-one 2,2-dioxide, 90%, 1-Methyl-2,2-dioxothieno(3,2-c)thiazin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one (CAS 214532-10-2) is a chemical compound with the molecular formula C7H7NO3S2 and a molecular weight of 217.3 g/mol. IUPAC name: 1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one. InChIKey: XRHDVPTVXFETBP-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3S2 |
|---|---|
| Molecular weight | 217.3 g/mol |
| IUPAC name | 1-methyl-2,2-dioxothieno[3,2-c]thiazin-4-one |
| InChIKey | XRHDVPTVXFETBP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)CS1(=O)=O)SC=C2 |
Computed by PubChem (NCBI)