CAS 214542-51-5 appears in our catalog under these names: 2-(3-Chloro-phenyl)-2,6-dihydro-4h-thieno(3,4-c)pyrazol-3-ylamine, 95%, 2-(3-Chlorophenyl)-2H,4H,6H-thieno(3,4-c)pyrazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(3-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-amine (CAS 214542-51-5) is a chemical compound with the molecular formula C11H10ClN3S and a molecular weight of 251.74 g/mol. IUPAC name: 2-(3-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-amine. InChIKey: ZOHAFLZSDSYPAF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3S |
|---|---|
| Molecular weight | 251.74 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazol-3-amine |
| InChIKey | ZOHAFLZSDSYPAF-UHFFFAOYSA-N |
| SMILES | C1C2=C(N(N=C2CS1)C3=CC(=CC=C3)Cl)N |
Computed by PubChem (NCBI)