CAS 214557-89-8 appears in our catalog under these names: 3,5,7-Trifluoroadamantane-1-carboxylic acid, 96%, 3,5,7-Trifluoroadamantane-1-carboxylic acid, 95%, 3,5,7–Trifluoroadamantane–1–carboxylic acid, 3,5,7-Trifluoroadamantane-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
3,5,7-trifluoroadamantane-1-carboxylic acid (CAS 214557-89-8) is a chemical compound with the molecular formula C11H13F3O2 and a molecular weight of 234.21 g/mol. IUPAC name: 3,5,7-trifluoroadamantane-1-carboxylic acid. InChIKey: QBRDOUHHJWRTHN-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O2 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 3,5,7-trifluoroadamantane-1-carboxylic acid |
| InChIKey | QBRDOUHHJWRTHN-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)F)F)F)C(=O)O |
Computed by PubChem (NCBI)