CAS 2145666-49-3 is the registry number for tert-Butyl ((3,3-dimethylcyclobutyl)methyl)(methyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3,3-dimethylcyclobutyl)methyl]-N-methylcarbamate (CAS 2145666-49-3) is a chemical compound with the molecular formula C13H25NO2 and a molecular weight of 227.34 g/mol. IUPAC name: tert-butyl N-[(3,3-dimethylcyclobutyl)methyl]-N-methylcarbamate. InChIKey: GUPFMNMIAANGCW-UHFFFAOYSA-N.
| Molecular formula | C13H25NO2 |
|---|---|
| Molecular weight | 227.34 g/mol |
| IUPAC name | tert-butyl N-[(3,3-dimethylcyclobutyl)methyl]-N-methylcarbamate |
| InChIKey | GUPFMNMIAANGCW-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)CN(C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)