CAS 2146095-56-7 appears in our catalog under these names: N,N',N'–Tris(3–pyridinyl) phosphorothioic triamide, N,N',N''-TRIS(3-PYRIDINYL) PHOSPHOROTHIOIC TRIAMIDE, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
N-bis(pyridin-3-ylamino)phosphinothioylpyridin-3-amine (CAS 2146095-56-7) is a chemical compound with the molecular formula C15H15N6PS and a molecular weight of 342.4 g/mol. IUPAC name: N-bis(pyridin-3-ylamino)phosphinothioylpyridin-3-amine. InChIKey: CJLUBXHBHRFISF-UHFFFAOYSA-N.
| Molecular formula | C15H15N6PS |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | N-bis(pyridin-3-ylamino)phosphinothioylpyridin-3-amine |
| InChIKey | CJLUBXHBHRFISF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NP(=S)(NC2=CN=CC=C2)NC3=CN=CC=C3 |
Computed by PubChem (NCBI)