Products 214691-87-9

CAS 214691-87-9 is the registry number for Methyl 2-(cyanomethanesulfonyl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(cyanomethylsulfonyl)acetate (CAS 214691-87-9) is a chemical compound with the molecular formula C5H7NO4S and a molecular weight of 177.18 g/mol. IUPAC name: methyl 2-(cyanomethylsulfonyl)acetate. InChIKey: SOXKVYVDFAGYCL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7NO4S
Molecular weight177.18 g/mol
IUPAC namemethyl 2-(cyanomethylsulfonyl)acetate
InChIKeySOXKVYVDFAGYCL-UHFFFAOYSA-N
SMILESCOC(=O)CS(=O)(=O)CC#N

Computed by PubChem (NCBI)