CAS 214707-72-9 is the registry number for 6-Deoxy-beta-L-galactopyranosyl Fluoride. Offered by: TRC. Available pack sizes: 100mg.
(2R,3S,4R,5S,6S)-2-fluoro-6-methyloxane-3,4,5-triol (CAS 214707-72-9) is a chemical compound with the molecular formula C6H11FO4 and a molecular weight of 166.15 g/mol. IUPAC name: (2R,3S,4R,5S,6S)-2-fluoro-6-methyloxane-3,4,5-triol. InChIKey: NEMRTLVVBHEBLV-KGJVWPDLSA-N.
| Molecular formula | C6H11FO4 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (2R,3S,4R,5S,6S)-2-fluoro-6-methyloxane-3,4,5-triol |
| InChIKey | NEMRTLVVBHEBLV-KGJVWPDLSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)F)O)O)O |
Computed by PubChem (NCBI)