CAS 2147709-94-0 is the registry number for P2X4-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-chlorophenyl)-N-[4-(4-cyanopyrazol-1-yl)-3-sulfamoylphenyl]acetamide (CAS 2147709-94-0) is a chemical compound with the molecular formula C18H14ClN5O3S and a molecular weight of 415.9 g/mol. IUPAC name: 2-(2-chlorophenyl)-N-[4-(4-cyanopyrazol-1-yl)-3-sulfamoylphenyl]acetamide. InChIKey: VLGCAGJBFFVXAV-UHFFFAOYSA-N.
| Molecular formula | C18H14ClN5O3S |
|---|---|
| Molecular weight | 415.9 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-N-[4-(4-cyanopyrazol-1-yl)-3-sulfamoylphenyl]acetamide |
| InChIKey | VLGCAGJBFFVXAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NC2=CC(=C(C=C2)N3C=C(C=N3)C#N)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)