CAS 214852-61-6 appears in our catalog under these names: Z–D–Dab(Boc)–OH · DCHA, Z-D-Dab(Boc)-OH*DCHA, Z-D-Dab(Boc)-OH·DCHA 97%, Z-D-Dab(Boc)-Oh DCHA, 97%, 97%, Z-D-Dab(Boc)-OH (dicyclohexylamine), 95.0%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100 mg, 250 mg, 1 g, 500 mg.
N-cyclohexylcyclohexanamine;(2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 214852-61-6) is a chemical compound with the molecular formula C29H47N3O6 and a molecular weight of 533.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: CYMIEBREXUYHGN-BTQNPOSSSA-N.
| Molecular formula | C29H47N3O6 |
|---|---|
| Molecular weight | 533.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | CYMIEBREXUYHGN-BTQNPOSSSA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)