CAS 2148975-91-9 appears in our catalog under these names: Methyl (S)-2-amino-3-((S)-2-oxopiperidin-3-yl)propanoate hydrochloride, 97%, 3-Piperidinepropanoic acid, α-amino-2-oxo-, methyl ester, hydrochloride (1:1), (αS,3S)-, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
Methyl (2S)-2-amino-3-[(3S)-2-oxopiperidin-3-yl]propanoate;hydrochloride (CAS 2148975-91-9) is a chemical compound with the molecular formula C9H17ClN2O3 and a molecular weight of 236.69 g/mol. IUPAC name: methyl (2S)-2-amino-3-[(3S)-2-oxopiperidin-3-yl]propanoate;hydrochloride. InChIKey: GCYWVOGKOSQSSZ-LEUCUCNGSA-N.
| Molecular formula | C9H17ClN2O3 |
|---|---|
| Molecular weight | 236.69 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-[(3S)-2-oxopiperidin-3-yl]propanoate;hydrochloride |
| InChIKey | GCYWVOGKOSQSSZ-LEUCUCNGSA-N |
| SMILES | COC(=O)[C@H](C[C@@H]1CCCNC1=O)N.Cl |
Computed by PubChem (NCBI)