Products 2149590-33-8

CAS 2149590-33-8 is the registry number for 3-Bromo-5-[(trifluoromethyl)sulfonyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-5-(trifluoromethylsulfonyl)benzoic acid (CAS 2149590-33-8) is a chemical compound with the molecular formula C8H4BrF3O4S and a molecular weight of 333.08 g/mol. IUPAC name: 3-bromo-5-(trifluoromethylsulfonyl)benzoic acid. InChIKey: UEFIUJGLBNIZJO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4BrF3O4S
Molecular weight333.08 g/mol
IUPAC name3-bromo-5-(trifluoromethylsulfonyl)benzoic acid
InChIKeyUEFIUJGLBNIZJO-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1S(=O)(=O)C(F)(F)F)Br)C(=O)O

Computed by PubChem (NCBI)