Products 2149596-11-0
CAS 2149596-11-0 is the registry number for Potassium (5-hydroxy-2-methylphenyl)trifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Potassium trifluoro-(5-hydroxy-2-methylphenyl)boranuide (CAS 2149596-11-0) is a chemical compound with the molecular formula C7H7BF3KO and a molecular weight of 214.04 g/mol. IUPAC name: potassium trifluoro-(5-hydroxy-2-methylphenyl)boranuide. InChIKey: JFDFOSXLTFTOKO-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3KO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | potassium trifluoro-(5-hydroxy-2-methylphenyl)boranuide |
| InChIKey | JFDFOSXLTFTOKO-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC(=C1)O)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)