CAS 2149597-44-2 is the registry number for 6-Amino-7-nitro-2,2,3,3-tetrafluoro-1,4-benzodioxane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxin-7-amine (CAS 2149597-44-2) is a chemical compound with the molecular formula C8H4F4N2O4 and a molecular weight of 268.12 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxin-7-amine. InChIKey: VVSOBOYDVQQMMC-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2O4 |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-6-nitro-1,4-benzodioxin-7-amine |
| InChIKey | VVSOBOYDVQQMMC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(C(O2)(F)F)(F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)