CAS 214976-90-6 appears in our catalog under these names: (S)-3-(Hydroxymethyl)-N-((S)-1-(Naphthalen-1-Yl)Ethyl)Pent-4-Enamide, 95%, 95%, (S)-3-(hydroxymethyl)-N-((S)-1-(naphthalen-1-yl)ethyl)pent-4-enamide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
(3S)-3-(hydroxymethyl)-N-[(1S)-1-naphthalen-1-ylethyl]pent-4-enamide (CAS 214976-90-6) is a chemical compound with the molecular formula C18H21NO2 and a molecular weight of 283.4 g/mol. IUPAC name: (3S)-3-(hydroxymethyl)-N-[(1S)-1-naphthalen-1-ylethyl]pent-4-enamide. InChIKey: ZNSWFZCGMQTFHD-UONOGXRCSA-N.
| Molecular formula | C18H21NO2 |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | (3S)-3-(hydroxymethyl)-N-[(1S)-1-naphthalen-1-ylethyl]pent-4-enamide |
| InChIKey | ZNSWFZCGMQTFHD-UONOGXRCSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)NC(=O)C[C@H](CO)C=C |
Computed by PubChem (NCBI)