CAS 21498-77-1 is the registry number for (((9,10-dioxoanthryl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[(9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile (CAS 21498-77-1) is a chemical compound with the molecular formula C18H9N3O2 and a molecular weight of 299.3 g/mol. IUPAC name: 2-[[(9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile. InChIKey: NYCRAOLNKZNZCO-UHFFFAOYSA-N.
| Molecular formula | C18H9N3O2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 2-[[(9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile |
| InChIKey | NYCRAOLNKZNZCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)NC=C(C#N)C#N |
Computed by PubChem (NCBI)