CAS 2150-48-3 appears in our catalog under these names: Pyronine b, 60%, Pyronin B, 98%, Pyronin B, Pyronine B, Pyronin B. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 5g, 25g, 1g, 500mg, 0,025kg, 0,5kg, 1kg, 2kg.
Pyronin B is an organic chloride salt having 6-(diethylamino)-N,N-diethyl-3H-xanthen-3-iminium as the cation. Depending on the mode of manufacture, pyronin B also exists in the form of an FeCl3 complex. It has a role as a histological dye. It is an iminium salt and an organic chloride salt. It contains a pyronin B(1+).
Source: ChEBI
| Molecular formula | C21H27ClN2O |
|---|---|
| Molecular weight | 358.9 g/mol |
| IUPAC name | [6-(diethylamino)xanthen-3-ylidene]-diethylazanium chloride |
| InChIKey | CXZRDVVUVDYSCQ-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C3C=CC(=[N+](CC)CC)C=C3O2.[Cl-] |
Computed by PubChem (NCBI)