Products 215108-39-7
CAS 215108-39-7 is the registry number for 2-Chloro-N6-cyclopentyl 2’-deoxy- adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 215108-39-7) is a chemical compound with the molecular formula C15H20ClN5O3 and a molecular weight of 353.80 g/mol. IUPAC name: (2R,3S,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: POVXZSUIRZLFEN-HBNTYKKESA-N.
| Molecular formula | C15H20ClN5O3 |
|---|---|
| Molecular weight | 353.80 g/mol |
| IUPAC name | (2R,3S,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | POVXZSUIRZLFEN-HBNTYKKESA-N |
| SMILES | C1CCC(C1)NC2=C3C(=NC(=N2)Cl)N(C=N3)[C@H]4C[C@@H]([C@H](O4)CO)O |
Computed by PubChem (NCBI)