CAS 215175-74-9 is the registry number for 3-((1S)-1-(2-Fluoro(1,1'-biphenyl)-4-yl)ethyl)-5-isoxazolamine. Offered by: TRC. Available pack sizes: 25mg.
3-[(1S)-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-amine (CAS 215175-74-9) is a chemical compound with the molecular formula C17H15FN2O and a molecular weight of 282.31 g/mol. IUPAC name: 3-[(1S)-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-amine. InChIKey: VKCFNPUWONHRSI-NSHDSACASA-N.
| Molecular formula | C17H15FN2O |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | 3-[(1S)-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-amine |
| InChIKey | VKCFNPUWONHRSI-NSHDSACASA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)C2=CC=CC=C2)F)C3=NOC(=C3)N |
Computed by PubChem (NCBI)