CAS 215175-83-0 is the registry number for 2-(4’-Acetyl-2-fluoro-biphenyl-4-yl)-propionic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Methyl 2-[4-(4-acetylphenyl)-3-fluorophenyl]propanoate (CAS 215175-83-0) is a chemical compound with the molecular formula C18H17FO3 and a molecular weight of 300.3 g/mol. IUPAC name: methyl 2-[4-(4-acetylphenyl)-3-fluorophenyl]propanoate. InChIKey: GSUUVAORLIYLIT-UHFFFAOYSA-N.
| Molecular formula | C18H17FO3 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | methyl 2-[4-(4-acetylphenyl)-3-fluorophenyl]propanoate |
| InChIKey | GSUUVAORLIYLIT-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=C(C=C2)C(=O)C)F)C(=O)OC |
Computed by PubChem (NCBI)