Products 215175-83-0

CAS 215175-83-0 is the registry number for 2-(4’-Acetyl-2-fluoro-biphenyl-4-yl)-propionic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-[4-(4-acetylphenyl)-3-fluorophenyl]propanoate (CAS 215175-83-0) is a chemical compound with the molecular formula C18H17FO3 and a molecular weight of 300.3 g/mol. IUPAC name: methyl 2-[4-(4-acetylphenyl)-3-fluorophenyl]propanoate. InChIKey: GSUUVAORLIYLIT-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17FO3
Molecular weight300.3 g/mol
IUPAC namemethyl 2-[4-(4-acetylphenyl)-3-fluorophenyl]propanoate
InChIKeyGSUUVAORLIYLIT-UHFFFAOYSA-N
SMILESCC(C1=CC(=C(C=C1)C2=CC=C(C=C2)C(=O)C)F)C(=O)OC

Computed by PubChem (NCBI)