CAS 2151847-03-7 appears in our catalog under these names: Alpinin A, Alpinin A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5-[(2R,4S,6R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxyoxan-2-yl]-3-methoxybenzene-1,2-diol (CAS 2151847-03-7) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: 5-[(2R,4S,6R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxyoxan-2-yl]-3-methoxybenzene-1,2-diol. InChIKey: CDLANTQZSUXRAX-PMUMKWKESA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 5-[(2R,4S,6R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-4-hydroxyoxan-2-yl]-3-methoxybenzene-1,2-diol |
| InChIKey | CDLANTQZSUXRAX-PMUMKWKESA-N |
| SMILES | COC1=CC(=CC(=C1O)O)[C@H]2C[C@H](C[C@H](O2)CCC3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)