CAS 21520-85-4 appears in our catalog under these names: 3,5–Diphenyl–1–(4–biphenylyl)formazan, 3,5-Diphenyl-1-(4-biphenylyl)formazan, 3,5-Diphenyl-1-(4-biphenylyl)formazan, 95%. Offered by: GLPBio, Chemat, Combi-blocks. Available pack sizes: 100mg, 1g, 500mg, 250mg.
N'-anilino-N-(4-phenylphenyl)iminobenzenecarboximidamide (CAS 21520-85-4) is a chemical compound with the molecular formula C25H20N4 and a molecular weight of 376.5 g/mol. IUPAC name: N'-anilino-N-(4-phenylphenyl)iminobenzenecarboximidamide. InChIKey: LKFXJYZDDITMNN-UHFFFAOYSA-N.
| Molecular formula | C25H20N4 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | N'-anilino-N-(4-phenylphenyl)iminobenzenecarboximidamide |
| InChIKey | LKFXJYZDDITMNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N=NC(=NNC3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)