Products 215248-52-5
CAS 215248-52-5 is the registry number for 4-{2-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)phenyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]benzoic acid (CAS 215248-52-5) is a chemical compound with the molecular formula C29H23NO4 and a molecular weight of 449.5 g/mol. IUPAC name: 4-[2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]benzoic acid. InChIKey: ZTXXEJOXTXBRJX-UHFFFAOYSA-N.
| Molecular formula | C29H23NO4 |
|---|---|
| Molecular weight | 449.5 g/mol |
| IUPAC name | 4-[2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]benzoic acid |
| InChIKey | ZTXXEJOXTXBRJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)