CAS 2152775-63-6 is the registry number for 1-(4-Bromo-3-fluoro-benzyl)-3,3-difluoro-pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(4-bromo-3-fluorophenyl)methyl]-3,3-difluoropyrrolidine (CAS 2152775-63-6) is a chemical compound with the molecular formula C11H11BrF3N and a molecular weight of 294.11 g/mol. IUPAC name: 1-[(4-bromo-3-fluorophenyl)methyl]-3,3-difluoropyrrolidine. InChIKey: GZZFUTFADLMZST-UHFFFAOYSA-N.
| Molecular formula | C11H11BrF3N |
|---|---|
| Molecular weight | 294.11 g/mol |
| IUPAC name | 1-[(4-bromo-3-fluorophenyl)methyl]-3,3-difluoropyrrolidine |
| InChIKey | GZZFUTFADLMZST-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)CC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)