Products 215294-98-7
CAS 215294-98-7 appears in our catalog under these names: X–34, X-34, X-34, 96.47%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 50mg, 25mg, 100mg, 5 mg, 10 mg.
5-[(E)-2-[4-[(E)-2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid (CAS 215294-98-7) is a chemical compound with the molecular formula C24H18O6 and a molecular weight of 402.4 g/mol. IUPAC name: 5-[(E)-2-[4-[(E)-2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid. InChIKey: MCBNOAYTZBUCSX-KQQUZDAGSA-N.
| Molecular formula | C24H18O6 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 5-[(E)-2-[4-[(E)-2-(3-carboxy-4-hydroxyphenyl)ethenyl]phenyl]ethenyl]-2-hydroxybenzoic acid |
| InChIKey | MCBNOAYTZBUCSX-KQQUZDAGSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=C(C=C2)O)C(=O)O)/C=C/C3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)