CAS 2154-33-8 appears in our catalog under these names: 3-Methoxycarbonyl PROXYL, 3-(Methoxycarbonyl)-2,2,5,5-tetramethyl-1-pyrrolidinyloxy. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Methyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate (CAS 2154-33-8) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: methyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate. InChIKey: VPKKKPWJDYOHLC-UHFFFAOYSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | methyl 1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| InChIKey | VPKKKPWJDYOHLC-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(N1O)(C)C)C(=O)OC)C |
Computed by PubChem (NCBI)