CAS 2154-67-8 appears in our catalog under these names: PQQH, 95%, 1-Hydroxy-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid, 95+%, 2,2,5,5-Tetramethyl-3-pyrrolin-1-oxyl-3-carboxylic acid, 99%. Offered by: Combi-blocks, Chemat Brand, Thermo Scientific (Acros). Available pack sizes: 1g, 250mg, on request, 5g.
CAS 2154-67-8 identifies a chemical compound with the molecular formula C9H14NO3 and a molecular weight of 184.21 g/mol. InChIKey: QILCUDCYZVIAQH-UHFFFAOYSA-N.
| Molecular formula | C9H14NO3 |
|---|---|
| Molecular weight | 184.21 g/mol |
| InChIKey | QILCUDCYZVIAQH-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C(N1[O])(C)C)C(=O)O)C |
Computed by PubChem (NCBI)