Products 2154605-83-9
CAS 2154605-83-9 is the registry number for tert-butyl (2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoate (CAS 2154605-83-9) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoate. InChIKey: SVLVBJGAHGTROD-RQJHMYQMSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (2S)-2-[[(2R)-2-aminopropanoyl]amino]propanoate |
| InChIKey | SVLVBJGAHGTROD-RQJHMYQMSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](C)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)