CAS 2488-26-8 appears in our catalog under these names: tert-Butyl L-alanyl-L-alaninate, 98%, tert-Butyl L-alanyl-L-alaninate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g, 10g.
Tert-butyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate (CAS 2488-26-8) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate. InChIKey: SVLVBJGAHGTROD-BQBZGAKWSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoate |
| InChIKey | SVLVBJGAHGTROD-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)